acetomeroctol

acetomeroctol

[‚as·ə‚tō·mə′räk·tȯl]
(pharmacology)
CH3COOHgC6H3(OH)C(CH3)2CH3C(CH3)3 A white solid with a melting point of 155-157°C; soluble in alcohol, ether, and chloroform; used as an antiseptic.